About 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine
1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine (PubChem CID 159564004) has the molecular formula C17H15FN4O
and a molecular weight of 310.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine |
| PubChem CID | 159564004 |
| Molecular Formula | C17H15FN4O |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine |
| SMILES | Cc1ccncn1.O=C(Cc1ccncn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H9FN2O.C5H6N2/c13-10-3-1-9(2-4-10)12(16)7-11-5-6-14-8-15-11;1-5-2-3-6-4-7-5/h1-6,8H,7H2;2-4H,1H3 |
| InChIKey | MGZAANDMYCLHOK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine?
The IUPAC name of 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine (CID 159564004) is 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine.
What is the SMILES notation for 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine?
The canonical SMILES for 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine is Cc1ccncn1.O=C(Cc1ccncn1)c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine?
The InChIKey is MGZAANDMYCLHOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O.C5H6N2/c13-10-3-1-9(2-4-10)12(16)7-11-5-6-14-8-15-11;1-5-2-3-6-4-7-5/h1-6,8H,7H2;2-4H,1H3.
What are the key properties of 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine?
1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine has a molecular weight of 310.33 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-2-pyrimidin-4-ylethanone;4-methylpyrimidine is sourced from PubChem (CID 159564004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).