C25H20F2N4O — CID 151411607
2,4-bis(4-fluorophenyl)-1,5-di(pyrimidin-4-yl)pentan-3-one (PubChem CID 151411607) has the molecular formula C25H20F2N4O and a molecular weight of 430.46 g/mol. Its IUPAC name is 2,4-bis(4-fluorophenyl)-1,5-di(pyrimidin-4-yl)pentan-3-one.
| Compound Name | 2,4-bis(4-fluorophenyl)-1,5-di(pyrimidin-4-yl)pentan-3-one |
|---|---|
| PubChem CID | 151411607 |
| Molecular Formula | C25H20F2N4O |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2,4-bis(4-fluorophenyl)-1,5-di(pyrimidin-4-yl)pentan-3-one |
| SMILES | O=C(C(Cc1ccncn1)c1ccc(F)cc1)C(Cc1ccncn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20F2N4O/c26-19-5-1-17(2-6-19)23(13-21-9-11-28-15-30-21)25(32)24(14-22-10-12-29-16-31-22)18-3-7-20(27)8-4-18/h1-12,15-16,23-24H,13-14H2 |
| InChIKey | OYQIFPSQDQLZPK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |