C13H9N3O3 — CID 116832856
5-(2-pyrimidin-4-ylacetyl)-3H-1,3-benzoxazol-2-one (PubChem CID 116832856) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is 5-(2-pyrimidin-4-ylacetyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(2-pyrimidin-4-ylacetyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116832856 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-(2-pyrimidin-4-ylacetyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(Cc1ccncn1)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H9N3O3/c17-11(6-9-3-4-14-7-15-9)8-1-2-12-10(5-8)16-13(18)19-12/h1-5,7H,6H2,(H,16,18) |
| InChIKey | BMLUWSIZBLSPGF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |