C14H14N2 — CID 116834301
2-(2,4-dimethylphenyl)-2-(1H-pyrrol-3-yl)acetonitrile (PubChem CID 116834301) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-2-(1H-pyrrol-3-yl)acetonitrile.
| Compound Name | 2-(2,4-dimethylphenyl)-2-(1H-pyrrol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 116834301 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-2-(1H-pyrrol-3-yl)acetonitrile |
| SMILES | Cc1ccc(C(C#N)c2cc[nH]c2)c(C)c1 |
| InChI | InChI=1S/C14H14N2/c1-10-3-4-13(11(2)7-10)14(8-15)12-5-6-16-9-12/h3-7,9,14,16H,1-2H3 |
| InChIKey | OUUNCCTVRPDEOZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |