C12H10FN3 — CID 116834529
2-(4-fluoro-3-methylphenyl)-2-(1H-imidazol-2-yl)acetonitrile (PubChem CID 116834529) has the molecular formula C12H10FN3 and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-2-(1H-imidazol-2-yl)acetonitrile.
| Compound Name | 2-(4-fluoro-3-methylphenyl)-2-(1H-imidazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 116834529 |
| Molecular Formula | C12H10FN3 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-2-(1H-imidazol-2-yl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ncc[nH]2)ccc1F |
| InChI | InChI=1S/C12H10FN3/c1-8-6-9(2-3-11(8)13)10(7-14)12-15-4-5-16-12/h2-6,10H,1H3,(H,15,16) |
| InChIKey | SGIUFTFTHUANCP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |