C9H6BrN3S — CID 116834593
2-(4-bromothiophen-2-yl)-2-(1H-imidazol-2-yl)acetonitrile (PubChem CID 116834593) has the molecular formula C9H6BrN3S and a molecular weight of 268.14 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-2-(1H-imidazol-2-yl)acetonitrile.
| Compound Name | 2-(4-bromothiophen-2-yl)-2-(1H-imidazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 116834593 |
| Molecular Formula | C9H6BrN3S |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-2-(1H-imidazol-2-yl)acetonitrile |
| SMILES | N#CC(c1ncc[nH]1)c1cc(Br)cs1 |
| InChI | InChI=1S/C9H6BrN3S/c10-6-3-8(14-5-6)7(4-11)9-12-1-2-13-9/h1-3,5,7H,(H,12,13) |
| InChIKey | RJQIGGOPGQQWEP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |