C27H28N4O2 — CID 11683639
(3E)-1-[1-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one (PubChem CID 11683639) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is (3E)-1-[1-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one.
| Compound Name | (3E)-1-[1-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 11683639 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (3E)-1-[1-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one |
| SMILES | COc1cc(/C=C2\CCCN(C(C)c3c[nH]c4ccccc34)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H28N4O2/c1-18-16-30(17-29-18)25-11-10-20(14-26(25)33-3)13-21-7-6-12-31(27(21)32)19(2)23-15-28-24-9-5-4-8-22(23)24/h4-5,8-11,13-17,19,28H,6-7,12H2,1-3H3/b21-13+ |
| InChIKey | RICGNPMCUHXZGL-FYJGNVAPSA-N |
| XLogP | 5.44 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|