C27H29N3O2 — CID 66960918
3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-methyl-1,3-dihydroinden-2-yl)piperidin-2-one (PubChem CID 66960918) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-methyl-1,3-dihydroinden-2-yl)piperidin-2-one.
| Compound Name | 3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-methyl-1,3-dihydroinden-2-yl)piperidin-2-one |
|---|---|
| PubChem CID | 66960918 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-methyl-1,3-dihydroinden-2-yl)piperidin-2-one |
| SMILES | COc1cc(C=C2CCCN(C3(C)Cc4ccccc4C3)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H29N3O2/c1-19-17-29(18-28-19)24-11-10-20(14-25(24)32-3)13-21-9-6-12-30(26(21)31)27(2)15-22-7-4-5-8-23(22)16-27/h4-5,7-8,10-11,13-14,17-18H,6,9,12,15-16H2,1-3H3 |
| InChIKey | ZVMJBNWUWJOYQU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|