C26H27N3O3 — CID 91116302
1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one (PubChem CID 91116302) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one.
| Compound Name | 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 91116302 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one |
| SMILES | COc1cc(C=C2CCCN([C@H]3COc4ccccc4C3)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H27N3O3/c1-18-15-28(17-27-18)23-10-9-19(13-25(23)31-2)12-21-7-5-11-29(26(21)30)22-14-20-6-3-4-8-24(20)32-16-22/h3-4,6,8-10,12-13,15,17,22H,5,7,11,14,16H2,1-2H3/t22-/m1/s1 |
| InChIKey | LDGFYPXQFRFBAB-JOCHJYFZSA-N |
| XLogP | 4.20 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|