C30H34N4O3 — CID 91507206
3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-[(1S)-5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl]piperidin-2-one (PubChem CID 91507206) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-[(1S)-5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl]piperidin-2-one.
| Compound Name | 3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-[(1S)-5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl]piperidin-2-one |
|---|---|
| PubChem CID | 91507206 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-[(1S)-5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl]piperidin-2-one |
| SMILES | COc1cc(C=C2CCCN([C@H]3CCc4cc(N5CCOCC5)ccc43)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C30H34N4O3/c1-21-19-33(20-31-21)28-9-5-22(17-29(28)36-2)16-24-4-3-11-34(30(24)35)27-10-6-23-18-25(7-8-26(23)27)32-12-14-37-15-13-32/h5,7-9,16-20,27H,3-4,6,10-15H2,1-2H3/t27-/m0/s1 |
| InChIKey | IVUSTGZWYYKJHT-MHZLTWQESA-N |
| XLogP | 4.72 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|