C30H35ClN4O3 — CID 66960274
(2E)-5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-(5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)pentanamide (PubChem CID 66960274) has the molecular formula C30H35ClN4O3 and a molecular weight of 535.09 g/mol. Its IUPAC name is (2E)-5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-(5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)pentanamide.
| Compound Name | (2E)-5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-(5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)pentanamide |
|---|---|
| PubChem CID | 66960274 |
| Molecular Formula | C30H35ClN4O3 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (2E)-5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-(5-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)pentanamide |
| SMILES | COc1cc(/C=C(\CCCCl)C(=O)NC2CCc3cc(N4CCOCC4)ccc32)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C30H35ClN4O3/c1-21-19-35(20-32-21)28-10-5-22(17-29(28)37-2)16-24(4-3-11-31)30(36)33-27-9-6-23-18-25(7-8-26(23)27)34-12-14-38-15-13-34/h5,7-8,10,16-20,27H,3-4,6,9,11-15H2,1-2H3,(H,33,36)/b24-16+ |
| InChIKey | YANCMHYSLCXPRS-LFVJCYFKSA-N |
| XLogP | 5.23 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|