C28H33N3O3 — CID 71216457
(2E)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]heptanamide (PubChem CID 71216457) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2E)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]heptanamide.
| Compound Name | (2E)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]heptanamide |
|---|---|
| PubChem CID | 71216457 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | (2E)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]heptanamide |
| SMILES | CCCCC/C(=C\c1ccc(-n2cnc(C)c2)c(OC)c1)C(=O)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C28H33N3O3/c1-4-5-6-10-22(28(33)30-27-23-11-8-7-9-21(23)16-25(27)32)14-20-12-13-24(26(15-20)34-3)31-17-19(2)29-18-31/h7-9,11-15,17-18,25,27,32H,4-6,10,16H2,1-3H3,(H,30,33)/b22-14+/t25-,27+/m0/s1 |
| InChIKey | RDANODYSLQKZPT-JCBOUGSRSA-N |
| XLogP | 4.93 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|