C26H27ClFN3O2 — CID 66961735
(2E)-5-chloro-N-(5-fluoro-2,3-dihydro-1H-inden-2-yl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide (PubChem CID 66961735) has the molecular formula C26H27ClFN3O2 and a molecular weight of 467.97 g/mol. Its IUPAC name is (2E)-5-chloro-N-(5-fluoro-2,3-dihydro-1H-inden-2-yl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide.
| Compound Name | (2E)-5-chloro-N-(5-fluoro-2,3-dihydro-1H-inden-2-yl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide |
|---|---|
| PubChem CID | 66961735 |
| Molecular Formula | C26H27ClFN3O2 |
| Molecular Weight | 467.97 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (2E)-5-chloro-N-(5-fluoro-2,3-dihydro-1H-inden-2-yl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide |
| SMILES | COc1cc(/C=C(\CCCCl)C(=O)NC2Cc3ccc(F)cc3C2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H27ClFN3O2/c1-17-15-31(16-29-17)24-8-5-18(11-25(24)33-2)10-20(4-3-9-27)26(32)30-23-13-19-6-7-22(28)12-21(19)14-23/h5-8,10-12,15-16,23H,3-4,9,13-14H2,1-2H3,(H,30,32)/b20-10+ |
| InChIKey | OQRVRTSGFQNELV-KEBDBYFISA-N |
| XLogP | 5.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.97 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|