C31H39ClN4O3 — CID 69477811
5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-[2-methyl-1-(4-morpholin-4-ylphenyl)propyl]pentanamide (PubChem CID 69477811) has the molecular formula C31H39ClN4O3 and a molecular weight of 551.13 g/mol. Its IUPAC name is 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-[2-methyl-1-(4-morpholin-4-ylphenyl)propyl]pentanamide.
| Compound Name | 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-[2-methyl-1-(4-morpholin-4-ylphenyl)propyl]pentanamide |
|---|---|
| PubChem CID | 69477811 |
| Molecular Formula | C31H39ClN4O3 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-N-[2-methyl-1-(4-morpholin-4-ylphenyl)propyl]pentanamide |
| SMILES | COc1cc(C=C(CCCCl)C(=O)NC(c2ccc(N3CCOCC3)cc2)C(C)C)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C31H39ClN4O3/c1-22(2)30(25-8-10-27(11-9-25)35-14-16-39-17-15-35)34-31(37)26(6-5-13-32)18-24-7-12-28(29(19-24)38-4)36-20-23(3)33-21-36/h7-12,18-22,30H,5-6,13-17H2,1-4H3,(H,34,37) |
| InChIKey | ABEKQWODSNAXEY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|