C26H27ClFN3O5 — CID 66961681
7-amino-5-chloro-6-(4-fluoro-3-methoxyphenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-oxoheptanoic acid (PubChem CID 66961681) has the molecular formula C26H27ClFN3O5 and a molecular weight of 515.97 g/mol. Its IUPAC name is 7-amino-5-chloro-6-(4-fluoro-3-methoxyphenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-oxoheptanoic acid.
| Compound Name | 7-amino-5-chloro-6-(4-fluoro-3-methoxyphenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 66961681 |
| Molecular Formula | C26H27ClFN3O5 |
| Molecular Weight | 515.97 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 7-amino-5-chloro-6-(4-fluoro-3-methoxyphenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-oxoheptanoic acid |
| SMILES | COc1cc(C(C(N)=O)C(Cl)CCC(=Cc2ccc(-n3cnc(C)c3)c(OC)c2)C(=O)O)ccc1F |
| InChI | InChI=1S/C26H27ClFN3O5/c1-15-13-31(14-30-15)21-9-4-16(11-23(21)36-3)10-18(26(33)34)5-7-19(27)24(25(29)32)17-6-8-20(28)22(12-17)35-2/h4,6,8-14,19,24H,5,7H2,1-3H3,(H2,29,32)(H,33,34) |
| InChIKey | BILHRPBCTXTXEI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.97 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|