C19H20ClF3N2O5 — CID 66960189
5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 66960189) has the molecular formula C19H20ClF3N2O5 and a molecular weight of 448.83 g/mol. Its IUPAC name is 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66960189 |
| Molecular Formula | C19H20ClF3N2O5 |
| Molecular Weight | 448.83 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(C=C(CCCCl)C(=O)O)ccc1-n1cnc(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19ClN2O3.C2HF3O2/c1-12-10-20(11-19-12)15-6-5-13(9-16(15)23-2)8-14(17(21)22)4-3-7-18;3-2(4,5)1(6)7/h5-6,8-11H,3-4,7H2,1-2H3,(H,21,22);(H,6,7) |
| InChIKey | JJQZVKSZZBAUCS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|