C19H23ClN2O3 — CID 142756510
(2E)-5-chloro-3-ethyl-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid (PubChem CID 142756510) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is (2E)-5-chloro-3-ethyl-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid.
| Compound Name | (2E)-5-chloro-3-ethyl-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid |
|---|---|
| PubChem CID | 142756510 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2E)-5-chloro-3-ethyl-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoic acid |
| SMILES | CCC(CCCl)/C(=C\c1ccc(-n2cnc(C)c2)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C19H23ClN2O3/c1-4-15(7-8-20)16(19(23)24)9-14-5-6-17(18(10-14)25-3)22-11-13(2)21-12-22/h5-6,9-12,15H,4,7-8H2,1-3H3,(H,23,24)/b16-9+ |
| InChIKey | PQSFPVTZPUSOKN-CXUHLZMHSA-N |
| XLogP | 4.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|