C26H30ClN3O5 — CID 67067364
(2,2-dimethoxy-2-pyridin-4-ylethyl) 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate (PubChem CID 67067364) has the molecular formula C26H30ClN3O5 and a molecular weight of 500.00 g/mol. Its IUPAC name is (2,2-dimethoxy-2-pyridin-4-ylethyl) 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate.
| Compound Name | (2,2-dimethoxy-2-pyridin-4-ylethyl) 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate |
|---|---|
| PubChem CID | 67067364 |
| Molecular Formula | C26H30ClN3O5 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (2,2-dimethoxy-2-pyridin-4-ylethyl) 5-chloro-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate |
| SMILES | COc1cc(C=C(CCCCl)C(=O)OCC(OC)(OC)c2ccncc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H30ClN3O5/c1-19-16-30(18-29-19)23-8-7-20(15-24(23)32-2)14-21(6-5-11-27)25(31)35-17-26(33-3,34-4)22-9-12-28-13-10-22/h7-10,12-16,18H,5-6,11,17H2,1-4H3 |
| InChIKey | NJBZOAKYSFDUTJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|