C26H29ClFN3O2 — CID 66961093
5-chloro-N-[2-(2-fluorophenyl)propan-2-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide (PubChem CID 66961093) has the molecular formula C26H29ClFN3O2 and a molecular weight of 469.99 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-fluorophenyl)propan-2-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide.
| Compound Name | 5-chloro-N-[2-(2-fluorophenyl)propan-2-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide |
|---|---|
| PubChem CID | 66961093 |
| Molecular Formula | C26H29ClFN3O2 |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 5-chloro-N-[2-(2-fluorophenyl)propan-2-yl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide |
| SMILES | COc1cc(C=C(CCCCl)C(=O)NC(C)(C)c2ccccc2F)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H29ClFN3O2/c1-18-16-31(17-29-18)23-12-11-19(15-24(23)33-4)14-20(8-7-13-27)25(32)30-26(2,3)21-9-5-6-10-22(21)28/h5-6,9-12,14-17H,7-8,13H2,1-4H3,(H,30,32) |
| InChIKey | CEKAGVQFPXEGSW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|