C24H23ClF3N3O — CID 90732807
5-chloro-N-[1-(2,4-difluorophenyl)ethyl]-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide (PubChem CID 90732807) has the molecular formula C24H23ClF3N3O and a molecular weight of 461.92 g/mol. Its IUPAC name is 5-chloro-N-[1-(2,4-difluorophenyl)ethyl]-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide.
| Compound Name | 5-chloro-N-[1-(2,4-difluorophenyl)ethyl]-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide |
|---|---|
| PubChem CID | 90732807 |
| Molecular Formula | C24H23ClF3N3O |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 5-chloro-N-[1-(2,4-difluorophenyl)ethyl]-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanamide |
| SMILES | Cc1cn(-c2ccc(C=C(CCCCl)C(=O)NC(C)c3ccc(F)cc3F)cc2F)cn1 |
| InChI | InChI=1S/C24H23ClF3N3O/c1-15-13-31(14-29-15)23-8-5-17(11-22(23)28)10-18(4-3-9-25)24(32)30-16(2)20-7-6-19(26)12-21(20)27/h5-8,10-14,16H,3-4,9H2,1-2H3,(H,30,32) |
| InChIKey | BTQYZYMRZVTVER-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|