C17H17Cl2FN2O — CID 142757570
(2E,4S)-5-chloro-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-methylpentanoyl chloride (PubChem CID 142757570) has the molecular formula C17H17Cl2FN2O and a molecular weight of 355.24 g/mol. Its IUPAC name is (2E,4S)-5-chloro-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-methylpentanoyl chloride.
| Compound Name | (2E,4S)-5-chloro-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-methylpentanoyl chloride |
|---|---|
| PubChem CID | 142757570 |
| Molecular Formula | C17H17Cl2FN2O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (2E,4S)-5-chloro-2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-methylpentanoyl chloride |
| SMILES | Cc1cn(-c2ccc(/C=C(\C[C@H](C)CCl)C(=O)Cl)cc2F)cn1 |
| InChI | InChI=1S/C17H17Cl2FN2O/c1-11(8-18)5-14(17(19)23)6-13-3-4-16(15(20)7-13)22-9-12(2)21-10-22/h3-4,6-7,9-11H,5,8H2,1-2H3/b14-6+/t11-/m0/s1 |
| InChIKey | PFQIXXKPUUJQHO-REPOHMLUSA-N |
| XLogP | 4.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|