C11H11FN2O — CID 91758264
[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methanol (PubChem CID 91758264) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is [3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methanol.
| Compound Name | [3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 91758264 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | [3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methanol |
| SMILES | Cc1cn(-c2ccc(CO)cc2F)cn1 |
| InChI | InChI=1S/C11H11FN2O/c1-8-5-14(7-13-8)11-3-2-9(6-15)4-10(11)12/h2-5,7,15H,6H2,1H3 |
| InChIKey | TVGKGYYAYHCSEL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |