C26H30FN3O3 — CID 66960251
ethyl 5-[(3-fluorophenyl)methylamino]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate (PubChem CID 66960251) has the molecular formula C26H30FN3O3 and a molecular weight of 451.54 g/mol. Its IUPAC name is ethyl 5-[(3-fluorophenyl)methylamino]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate.
| Compound Name | ethyl 5-[(3-fluorophenyl)methylamino]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate |
|---|---|
| PubChem CID | 66960251 |
| Molecular Formula | C26H30FN3O3 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | ethyl 5-[(3-fluorophenyl)methylamino]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]pentanoate |
| SMILES | CCOC(=O)C(=Cc1ccc(-n2cnc(C)c2)c(OC)c1)CCCNCc1cccc(F)c1 |
| InChI | InChI=1S/C26H30FN3O3/c1-4-33-26(31)22(8-6-12-28-16-21-7-5-9-23(27)14-21)13-20-10-11-24(25(15-20)32-3)30-17-19(2)29-18-30/h5,7,9-11,13-15,17-18,28H,4,6,8,12,16H2,1-3H3 |
| InChIKey | DKVVVRSFCCSUCD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|