C24H23F4N3O5 — CID 66961577
N-[2-(3-fluorophenoxy)ethyl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 66961577) has the molecular formula C24H23F4N3O5 and a molecular weight of 509.46 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66961577 |
| Molecular Formula | C24H23F4N3O5 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(C=CC(=O)NCCOc2cccc(F)c2)ccc1-n1cnc(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H22FN3O3.C2HF3O2/c1-16-14-26(15-25-16)20-8-6-17(12-21(20)28-2)7-9-22(27)24-10-11-29-19-5-3-4-18(23)13-19;3-2(4,5)1(6)7/h3-9,12-15H,10-11H2,1-2H3,(H,24,27);(H,6,7) |
| InChIKey | MNUUGAWQCTUPOL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|