C25H29N3O3 — CID 59170803
(E)-N-(3-hydroxy-3-methyl-1-phenylbutan-2-yl)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide (PubChem CID 59170803) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (E)-N-(3-hydroxy-3-methyl-1-phenylbutan-2-yl)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(3-hydroxy-3-methyl-1-phenylbutan-2-yl)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59170803 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (E)-N-(3-hydroxy-3-methyl-1-phenylbutan-2-yl)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC(Cc2ccccc2)C(C)(C)O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H29N3O3/c1-18-16-28(17-26-18)21-12-10-20(14-22(21)31-4)11-13-24(29)27-23(25(2,3)30)15-19-8-6-5-7-9-19/h5-14,16-17,23,30H,15H2,1-4H3,(H,27,29)/b13-11+ |
| InChIKey | IZUZEXIXKUSFTJ-ACCUITESSA-N |
| XLogP | 3.70 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|