C29H36N4O3 — CID 66960279
N-[(2R)-1-(2,6-dimethylmorpholin-4-yl)-3-phenylpropan-2-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide (PubChem CID 66960279) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[(2R)-1-(2,6-dimethylmorpholin-4-yl)-3-phenylpropan-2-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[(2R)-1-(2,6-dimethylmorpholin-4-yl)-3-phenylpropan-2-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66960279 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | N-[(2R)-1-(2,6-dimethylmorpholin-4-yl)-3-phenylpropan-2-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)N[C@H](Cc2ccccc2)CN2CC(C)OC(C)C2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C29H36N4O3/c1-21-16-33(20-30-21)27-12-10-25(15-28(27)35-4)11-13-29(34)31-26(14-24-8-6-5-7-9-24)19-32-17-22(2)36-23(3)18-32/h5-13,15-16,20,22-23,26H,14,17-19H2,1-4H3,(H,31,34)/t22?,23?,26-/m1/s1 |
| InChIKey | KTNFUFIMPMLIKL-QGPIEZSZSA-N |
| XLogP | 4.04 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|