C24H24F3N3O5 — CID 66961666
(E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2-phenoxyethyl)prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 66961666) has the molecular formula C24H24F3N3O5 and a molecular weight of 491.47 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2-phenoxyethyl)prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2-phenoxyethyl)prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66961666 |
| Molecular Formula | C24H24F3N3O5 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2-phenoxyethyl)prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(/C=C/C(=O)NCCOc2ccccc2)ccc1-n1cnc(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H23N3O3.C2HF3O2/c1-17-15-25(16-24-17)20-10-8-18(14-21(20)27-2)9-11-22(26)23-12-13-28-19-6-4-3-5-7-19;3-2(4,5)1(6)7/h3-11,14-16H,12-13H2,1-2H3,(H,23,26);(H,6,7)/b11-9+; |
| InChIKey | LIBXJRVSRFLDBP-LBEJWNQZSA-N |
| XLogP | 4.03 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|