C24H22FN3O — CID 161463309
2-[(3-fluorophenyl)methyl]-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyridine (PubChem CID 161463309) has the molecular formula C24H22FN3O and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyridine.
| Compound Name | 2-[(3-fluorophenyl)methyl]-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyridine |
|---|---|
| PubChem CID | 161463309 |
| Molecular Formula | C24H22FN3O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyridine |
| SMILES | COc1cc(Cc2cccc(Cc3cccc(F)c3)n2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H22FN3O/c1-17-15-28(16-26-17)23-10-9-19(14-24(23)29-2)13-22-8-4-7-21(27-22)12-18-5-3-6-20(25)11-18/h3-11,14-16H,12-13H2,1-2H3 |
| InChIKey | WCCFXPABACXOQE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |