C19H20N4O3 — CID 161238815
[2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyrimidin-4-yl]methyl acetate (PubChem CID 161238815) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyrimidin-4-yl]methyl acetate.
| Compound Name | [2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyrimidin-4-yl]methyl acetate |
|---|---|
| PubChem CID | 161238815 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]pyrimidin-4-yl]methyl acetate |
| SMILES | COc1cc(Cc2nccc(COC(C)=O)n2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-13-10-23(12-21-13)17-5-4-15(8-18(17)25-3)9-19-20-7-6-16(22-19)11-26-14(2)24/h4-8,10,12H,9,11H2,1-3H3 |
| InChIKey | UZSMTNQQKVUYEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |