C30H37N3O4 — CID 66960963
ethyl (2Z)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pentanoate (PubChem CID 66960963) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is ethyl (2Z)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pentanoate.
| Compound Name | ethyl (2Z)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pentanoate |
|---|---|
| PubChem CID | 66960963 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | ethyl (2Z)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pentanoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(-n2cnc(C)c2)c(OC)c1)CCCNC1CCCc2ccc(OC)cc21 |
| InChI | InChI=1S/C30H37N3O4/c1-5-37-30(34)24(16-22-11-14-28(29(17-22)36-4)33-19-21(2)32-20-33)9-7-15-31-27-10-6-8-23-12-13-25(35-3)18-26(23)27/h11-14,16-20,27,31H,5-10,15H2,1-4H3/b24-16- |
| InChIKey | LIWMGXWFYLVWDL-JLPGSUDCSA-N |
| XLogP | 5.59 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|