C25H26Cl2N4O3 — CID 77220303
5-chloro-2-(4-chlorophenyl)-N'-[3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]pentanehydrazide (PubChem CID 77220303) has the molecular formula C25H26Cl2N4O3 and a molecular weight of 501.41 g/mol. Its IUPAC name is 5-chloro-2-(4-chlorophenyl)-N'-[3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]pentanehydrazide.
| Compound Name | 5-chloro-2-(4-chlorophenyl)-N'-[3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]pentanehydrazide |
|---|---|
| PubChem CID | 77220303 |
| Molecular Formula | C25H26Cl2N4O3 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 5-chloro-2-(4-chlorophenyl)-N'-[3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]pentanehydrazide |
| SMILES | COc1cc(C=CC(=O)NNC(=O)C(CCCCl)c2ccc(Cl)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H26Cl2N4O3/c1-17-15-31(16-28-17)22-11-5-18(14-23(22)34-2)6-12-24(32)29-30-25(33)21(4-3-13-26)19-7-9-20(27)10-8-19/h5-12,14-16,21H,3-4,13H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | QUYKMWDYGMJEGO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|