C24H23ClF3N5O3 — CID 77194981
5-chloro-N'-[3-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]prop-2-enoyl]-2-(3,4,5-trifluorophenyl)pentanehydrazide (PubChem CID 77194981) has the molecular formula C24H23ClF3N5O3 and a molecular weight of 521.93 g/mol. Its IUPAC name is 5-chloro-N'-[3-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]prop-2-enoyl]-2-(3,4,5-trifluorophenyl)pentanehydrazide.
| Compound Name | 5-chloro-N'-[3-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]prop-2-enoyl]-2-(3,4,5-trifluorophenyl)pentanehydrazide |
|---|---|
| PubChem CID | 77194981 |
| Molecular Formula | C24H23ClF3N5O3 |
| Molecular Weight | 521.93 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 5-chloro-N'-[3-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]prop-2-enoyl]-2-(3,4,5-trifluorophenyl)pentanehydrazide |
| SMILES | COc1cc(C=CC(=O)NNC(=O)C(CCCCl)c2cc(F)c(F)c(F)c2)cnc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H23ClF3N5O3/c1-14-12-33(13-30-14)23-20(36-2)8-15(11-29-23)5-6-21(34)31-32-24(35)17(4-3-7-25)16-9-18(26)22(28)19(27)10-16/h5-6,8-13,17H,3-4,7H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | VOVJPLYVDWKGNZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.93 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|