C25H21ClF4N4O2 — CID 89406529
2-[(1S)-4-chloro-1-(3,4,5-trifluorophenyl)butyl]-5-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,3,4-oxadiazole (PubChem CID 89406529) has the molecular formula C25H21ClF4N4O2 and a molecular weight of 520.91 g/mol. Its IUPAC name is 2-[(1S)-4-chloro-1-(3,4,5-trifluorophenyl)butyl]-5-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(1S)-4-chloro-1-(3,4,5-trifluorophenyl)butyl]-5-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 89406529 |
| Molecular Formula | C25H21ClF4N4O2 |
| Molecular Weight | 520.91 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 2-[(1S)-4-chloro-1-(3,4,5-trifluorophenyl)butyl]-5-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,3,4-oxadiazole |
| SMILES | COc1cc(/C=C(\F)c2nnc([C@@H](CCCCl)c3cc(F)c(F)c(F)c3)o2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H21ClF4N4O2/c1-14-12-34(13-31-14)21-6-5-15(9-22(21)35-2)8-20(29)25-33-32-24(36-25)17(4-3-7-26)16-10-18(27)23(30)19(28)11-16/h5-6,8-13,17H,3-4,7H2,1-2H3/b20-8-/t17-/m0/s1 |
| InChIKey | NKHPOLHQTPDWAO-YKAVCUTLSA-N |
| XLogP | 6.61 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.91 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|