C27H30F3N3O3 — CID 70819882
(E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-[2-methoxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methyl-N-propylprop-2-enamide (PubChem CID 70819882) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-[2-methoxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methyl-N-propylprop-2-enamide.
| Compound Name | (E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-[2-methoxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methyl-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 70819882 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-[2-methoxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methyl-N-propylprop-2-enamide |
| SMILES | CCCN(C(=O)/C(C)=C/c1ccc(-n2cnc(C)c2)c(OC)c1)C(COC)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C27H30F3N3O3/c1-6-9-33(24(15-35-4)20-12-21(28)26(30)22(29)13-20)27(34)17(2)10-19-7-8-23(25(11-19)36-5)32-14-18(3)31-16-32/h7-8,10-14,16,24H,6,9,15H2,1-5H3/b17-10+ |
| InChIKey | BIBIIDAWNABMDH-LICLKQGHSA-N |
| XLogP | 5.64 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|