C27H28F3N5O2 — CID 136657362
2-butylimino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-[1-(3,4,5-trifluorophenyl)ethyl]imidazolidin-4-one (PubChem CID 136657362) has the molecular formula C27H28F3N5O2 and a molecular weight of 511.55 g/mol. Its IUPAC name is 2-butylimino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-[1-(3,4,5-trifluorophenyl)ethyl]imidazolidin-4-one.
| Compound Name | 2-butylimino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-[1-(3,4,5-trifluorophenyl)ethyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 136657362 |
| Molecular Formula | C27H28F3N5O2 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-butylimino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-[1-(3,4,5-trifluorophenyl)ethyl]imidazolidin-4-one |
| SMILES | CCCC/N=C1\NC(=Cc2ccc(-n3cnc(C)c3)c(OC)c2)C(=O)N1C(C)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C27H28F3N5O2/c1-5-6-9-31-27-33-22(26(36)35(27)17(3)19-12-20(28)25(30)21(29)13-19)10-18-7-8-23(24(11-18)37-4)34-14-16(2)32-15-34/h7-8,10-15,17H,5-6,9H2,1-4H3,(H,31,33) |
| InChIKey | BQCWGTNQINGPEQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|