C18H20N6O3 — CID 143785611
(5Z)-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3-nitrosopropylimino)imidazolidin-4-one (PubChem CID 143785611) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is (5Z)-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3-nitrosopropylimino)imidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3-nitrosopropylimino)imidazolidin-4-one |
|---|---|
| PubChem CID | 143785611 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (5Z)-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3-nitrosopropylimino)imidazolidin-4-one |
| SMILES | COc1cc(/C=C2\N/C(=N/CCCN=O)NC2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C18H20N6O3/c1-12-10-24(11-20-12)15-5-4-13(9-16(15)27-2)8-14-17(25)23-18(22-14)19-6-3-7-21-26/h4-5,8-11H,3,6-7H2,1-2H3,(H2,19,22,23,25)/b14-8- |
| InChIKey | NSUJJTFQHNNEQG-ZSOIEALJSA-N |
| XLogP | 1.76 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|