C25H24F3N3O3 — CID 16739018
(2Z,6S)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methyl-4-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]morpholin-3-one (PubChem CID 16739018) has the molecular formula C25H24F3N3O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is (2Z,6S)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methyl-4-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]morpholin-3-one.
| Compound Name | (2Z,6S)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methyl-4-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]morpholin-3-one |
|---|---|
| PubChem CID | 16739018 |
| Molecular Formula | C25H24F3N3O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (2Z,6S)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methyl-4-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]morpholin-3-one |
| SMILES | COc1cc(/C=C2\O[C@@H](C)CN([C@@H](C)c3cc(F)c(F)c(F)c3)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H24F3N3O3/c1-14-11-30(13-29-14)21-6-5-17(7-22(21)33-4)8-23-25(32)31(12-15(2)34-23)16(3)18-9-19(26)24(28)20(27)10-18/h5-11,13,15-16H,12H2,1-4H3/b23-8-/t15-,16-/m0/s1 |
| InChIKey | PMCMFQJLUIRZCQ-CCFPEVQYSA-N |
| XLogP | 4.96 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|