C23H22ClFN4O3 — CID 143467329
(2Z)-4-[1-(2-chloro-3-fluoro-4-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]morpholin-3-one (PubChem CID 143467329) has the molecular formula C23H22ClFN4O3 and a molecular weight of 456.91 g/mol. Its IUPAC name is (2Z)-4-[1-(2-chloro-3-fluoro-4-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]morpholin-3-one.
| Compound Name | (2Z)-4-[1-(2-chloro-3-fluoro-4-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]morpholin-3-one |
|---|---|
| PubChem CID | 143467329 |
| Molecular Formula | C23H22ClFN4O3 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (2Z)-4-[1-(2-chloro-3-fluoro-4-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]morpholin-3-one |
| SMILES | COc1cc(/C=C2\OCCN(C(C)c3ccnc(Cl)c3F)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C23H22ClFN4O3/c1-14-12-28(13-27-14)18-5-4-16(10-19(18)31-3)11-20-23(30)29(8-9-32-20)15(2)17-6-7-26-22(24)21(17)25/h4-7,10-13,15H,8-9H2,1-3H3/b20-11- |
| InChIKey | UJHCGLMXFYBVOO-JAIQZWGSSA-N |
| XLogP | 4.34 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|