C26H24F3N3O3 — CID 90867734
(6S,9aR)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one (PubChem CID 90867734) has the molecular formula C26H24F3N3O3 and a molecular weight of 483.49 g/mol. Its IUPAC name is (6S,9aR)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one.
| Compound Name | (6S,9aR)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 90867734 |
| Molecular Formula | C26H24F3N3O3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (6S,9aR)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
| SMILES | COc1cc(C=C2OC[C@H]3CCC[C@@H](c4cc(F)c(F)c(F)c4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H24F3N3O3/c1-15-12-31(14-30-15)22-7-6-16(8-23(22)34-2)9-24-26(33)32-18(13-35-24)4-3-5-21(32)17-10-19(27)25(29)20(28)11-17/h6-12,14,18,21H,3-5,13H2,1-2H3/t18-,21+/m1/s1 |
| InChIKey | JRONOZRAAQIDMK-NQIIRXRSSA-N |
| XLogP | 5.10 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|