C28H29F3N4O2 — CID 67462939
(4R,9aR)-2-ethyl-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-6-one (PubChem CID 67462939) has the molecular formula C28H29F3N4O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is (4R,9aR)-2-ethyl-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-6-one.
| Compound Name | (4R,9aR)-2-ethyl-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 67462939 |
| Molecular Formula | C28H29F3N4O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (4R,9aR)-2-ethyl-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-6-one |
| SMILES | CCN1C[C@H]2CCC(=Cc3ccc(-n4cnc(C)c4)c(OC)c3)C(=O)N2[C@H](c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C28H29F3N4O2/c1-4-33-14-21-7-6-19(9-18-5-8-24(26(10-18)37-3)34-13-17(2)32-16-34)28(36)35(21)25(15-33)20-11-22(29)27(31)23(30)12-20/h5,8-13,16,21,25H,4,6-7,14-15H2,1-3H3/t21-,25+/m1/s1 |
| InChIKey | DRUVMOXWCGCOEK-BWKNWUBXSA-N |
| XLogP | 5.06 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|