C26H25F2N3O2 — CID 67461496
(3S,8aS)-3-(2,3-difluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one (PubChem CID 67461496) has the molecular formula C26H25F2N3O2 and a molecular weight of 449.50 g/mol. Its IUPAC name is (3S,8aS)-3-(2,3-difluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (3S,8aS)-3-(2,3-difluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 67461496 |
| Molecular Formula | C26H25F2N3O2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (3S,8aS)-3-(2,3-difluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one |
| SMILES | COc1cc(C=C2CC[C@H]3CC[C@@H](c4cccc(F)c4F)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H25F2N3O2/c1-16-14-30(15-29-16)23-10-6-17(13-24(23)33-2)12-18-7-8-19-9-11-22(31(19)26(18)32)20-4-3-5-21(27)25(20)28/h3-6,10,12-15,19,22H,7-9,11H2,1-2H3/t19-,22-/m0/s1 |
| InChIKey | RFMZZGWMQSCMRQ-UGKGYDQZSA-N |
| XLogP | 5.38 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|