C25H23F2N3O4 — CID 16738743
(3Z,6R,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one (PubChem CID 16738743) has the molecular formula C25H23F2N3O4 and a molecular weight of 467.47 g/mol. Its IUPAC name is (3Z,6R,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one.
| Compound Name | (3Z,6R,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 16738743 |
| Molecular Formula | C25H23F2N3O4 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (3Z,6R,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one |
| SMILES | COc1cc(/C=C2\OC[C@H]3COC[C@@H](c4ccc(F)c(F)c4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H23F2N3O4/c1-15-10-29(14-28-15)21-6-3-16(7-23(21)32-2)8-24-25(31)30-18(12-34-24)11-33-13-22(30)17-4-5-19(26)20(27)9-17/h3-10,14,18,22H,11-13H2,1-2H3/b24-8-/t18-,22+/m1/s1 |
| InChIKey | BOGUBTXGHLNJHC-MUSOGDBWSA-N |
| XLogP | 3.81 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|