C24H24F2N4O3 — CID 68719011
(6S)-4-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methylmorpholin-3-one (PubChem CID 68719011) has the molecular formula C24H24F2N4O3 and a molecular weight of 454.48 g/mol. Its IUPAC name is (6S)-4-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methylmorpholin-3-one.
| Compound Name | (6S)-4-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methylmorpholin-3-one |
|---|---|
| PubChem CID | 68719011 |
| Molecular Formula | C24H24F2N4O3 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (6S)-4-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-methylmorpholin-3-one |
| SMILES | COc1cc(C=C2O[C@@H](C)CN([C@@H](C)c3ccc(F)nc3F)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H24F2N4O3/c1-14-11-29(13-27-14)19-7-5-17(9-20(19)32-4)10-21-24(31)30(12-15(2)33-21)16(3)18-6-8-22(25)28-23(18)26/h5-11,13,15-16H,12H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | AAEZTTNHBRYTJD-HOTGVXAUSA-N |
| XLogP | 4.21 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|