C27H27F3N4O4 — CID 25143208
1-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-methyl-4-(3,4,5-trifluorophenyl)-6,7-dihydro-3H-[1,4]oxazino[3,4-c][1,2,4]oxadiazin-4-yl]ethanol (PubChem CID 25143208) has the molecular formula C27H27F3N4O4 and a molecular weight of 528.53 g/mol. Its IUPAC name is 1-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-methyl-4-(3,4,5-trifluorophenyl)-6,7-dihydro-3H-[1,4]oxazino[3,4-c][1,2,4]oxadiazin-4-yl]ethanol.
| Compound Name | 1-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-methyl-4-(3,4,5-trifluorophenyl)-6,7-dihydro-3H-[1,4]oxazino[3,4-c][1,2,4]oxadiazin-4-yl]ethanol |
|---|---|
| PubChem CID | 25143208 |
| Molecular Formula | C27H27F3N4O4 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 1-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-7-methyl-4-(3,4,5-trifluorophenyl)-6,7-dihydro-3H-[1,4]oxazino[3,4-c][1,2,4]oxadiazin-4-yl]ethanol |
| SMILES | COc1cc(/C=C2/OC(C)CN3C2=NOCC3(c2cc(F)c(F)c(F)c2)C(C)O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H27F3N4O4/c1-15-11-33(14-31-15)22-6-5-18(7-23(22)36-4)8-24-26-32-37-13-27(17(3)35,34(26)12-16(2)38-24)19-9-20(28)25(30)21(29)10-19/h5-11,14,16-17,35H,12-13H2,1-4H3/b24-8+ |
| InChIKey | LOILIXNGHDEYSI-KTZMUZOWSA-N |
| XLogP | 4.29 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|