C22H20FN5O3S — CID 123320888
3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6-dihydro-[1,2,3,5]thiatriazolo[4,3-c][1,4]oxazine 2-oxide (PubChem CID 123320888) has the molecular formula C22H20FN5O3S and a molecular weight of 453.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6-dihydro-[1,2,3,5]thiatriazolo[4,3-c][1,4]oxazine 2-oxide.
| Compound Name | 3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6-dihydro-[1,2,3,5]thiatriazolo[4,3-c][1,4]oxazine 2-oxide |
|---|---|
| PubChem CID | 123320888 |
| Molecular Formula | C22H20FN5O3S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6-dihydro-[1,2,3,5]thiatriazolo[4,3-c][1,4]oxazine 2-oxide |
| SMILES | COc1cc(C=C2OCCN3C2=NS(=O)N3c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C22H20FN5O3S/c1-15-13-26(14-24-15)19-8-3-16(11-20(19)30-2)12-21-22-25-32(29)28(27(22)9-10-31-21)18-6-4-17(23)5-7-18/h3-8,11-14H,9-10H2,1-2H3 |
| InChIKey | SWTLUFBRDKSJOM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |