C25H26FN5O — CID 67678911
(8E)-3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-methyl-2,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 67678911) has the molecular formula C25H26FN5O and a molecular weight of 431.52 g/mol. Its IUPAC name is (8E)-3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-methyl-2,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | (8E)-3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-methyl-2,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 67678911 |
| Molecular Formula | C25H26FN5O |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (8E)-3-(4-fluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-methyl-2,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(/C=C2\CCCN3C2=NC(C)N3c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H26FN5O/c1-17-15-29(16-27-17)23-11-6-19(14-24(23)32-3)13-20-5-4-12-30-25(20)28-18(2)31(30)22-9-7-21(26)8-10-22/h6-11,13-16,18H,4-5,12H2,1-3H3/b20-13+ |
| InChIKey | MLJZYFPVAHLOQE-DEDYPNTBSA-N |
| XLogP | 4.99 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |