C31H28FN5O2 — CID 75171421
4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazin-2-one (PubChem CID 75171421) has the molecular formula C31H28FN5O2 and a molecular weight of 521.60 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazin-2-one.
| Compound Name | 4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazin-2-one |
|---|---|
| PubChem CID | 75171421 |
| Molecular Formula | C31H28FN5O2 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazin-2-one |
| SMILES | COc1cc(C=C2CCCN3C2=NC(=O)C(c2ccccc2)N3c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C31H28FN5O2/c1-21-19-35(20-33-21)27-15-10-22(18-28(27)39-2)17-24-9-6-16-36-30(24)34-31(38)29(23-7-4-3-5-8-23)37(36)26-13-11-25(32)12-14-26/h3-5,7-8,10-15,17-20,29H,6,9,16H2,1-2H3 |
| InChIKey | WNXIGJICILEOQN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |