C33H33FN4O2 — CID 90788319
1-(4-fluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-phenyl-3,5,5a,7,8,9-hexahydro-2H-pyrido[1,2-b]diazepin-4-one (PubChem CID 90788319) has the molecular formula C33H33FN4O2 and a molecular weight of 536.65 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-phenyl-3,5,5a,7,8,9-hexahydro-2H-pyrido[1,2-b]diazepin-4-one.
| Compound Name | 1-(4-fluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-phenyl-3,5,5a,7,8,9-hexahydro-2H-pyrido[1,2-b]diazepin-4-one |
|---|---|
| PubChem CID | 90788319 |
| Molecular Formula | C33H33FN4O2 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 1-(4-fluorophenyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-phenyl-3,5,5a,7,8,9-hexahydro-2H-pyrido[1,2-b]diazepin-4-one |
| SMILES | COc1cc(C=C2CCCN3C2CC(=O)CC(c2ccccc2)N3c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C33H33FN4O2/c1-23-21-36(22-35-23)30-15-10-24(18-33(30)40-2)17-26-9-6-16-37-31(26)19-29(39)20-32(25-7-4-3-5-8-25)38(37)28-13-11-27(34)12-14-28/h3-5,7-8,10-15,17-18,21-22,31-32H,6,9,16,19-20H2,1-2H3 |
| InChIKey | BIXTUBXYBKSUBC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |