C29H34FN3O2 — CID 143467364
(4E,7aR)-11-(4-fluorophenyl)-4-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6,7,7a,8,9,10,11-octahydro-1H-pyrido[1,2-c][1,3]oxazonine (PubChem CID 143467364) has the molecular formula C29H34FN3O2 and a molecular weight of 475.61 g/mol. Its IUPAC name is (4E,7aR)-11-(4-fluorophenyl)-4-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6,7,7a,8,9,10,11-octahydro-1H-pyrido[1,2-c][1,3]oxazonine.
| Compound Name | (4E,7aR)-11-(4-fluorophenyl)-4-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6,7,7a,8,9,10,11-octahydro-1H-pyrido[1,2-c][1,3]oxazonine |
|---|---|
| PubChem CID | 143467364 |
| Molecular Formula | C29H34FN3O2 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | (4E,7aR)-11-(4-fluorophenyl)-4-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-5,6,7,7a,8,9,10,11-octahydro-1H-pyrido[1,2-c][1,3]oxazonine |
| SMILES | COc1cc(/C=C2\CCC[C@@H]3CCCC(c4ccc(F)cc4)N3COC2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C29H34FN3O2/c1-21-17-32(19-31-21)28-14-9-22(16-29(28)34-2)15-23-5-3-6-26-7-4-8-27(33(26)20-35-18-23)24-10-12-25(30)13-11-24/h9-17,19,26-27H,3-8,18,20H2,1-2H3/b23-15+/t26-,27?/m1/s1 |
| InChIKey | WXKZPYVYQLTMER-VGJFJKDISA-N |
| XLogP | 6.47 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |