C26H27FN4O2 — CID 46216528
(3R,10E)-3-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine (PubChem CID 46216528) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is (3R,10E)-3-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine.
| Compound Name | (3R,10E)-3-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
|---|---|
| PubChem CID | 46216528 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (3R,10E)-3-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
| SMILES | COc1cc(/C=C2\CCCN3CC[C@H](c4ccc(F)cc4)ON=C23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H27FN4O2/c1-18-16-31(17-28-18)23-10-5-19(15-25(23)32-2)14-21-4-3-12-30-13-11-24(33-29-26(21)30)20-6-8-22(27)9-7-20/h5-10,14-17,24H,3-4,11-13H2,1-2H3/b21-14+/t24-/m1/s1 |
| InChIKey | RCGSXNNEINRPEU-JRXNCPAPSA-N |
| XLogP | 5.28 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |